C18H29NO2 — CID 69268670
2-(aminomethyl)-7-(2,5-dimethylphenyl)-4-ethylheptanoic acid (PubChem CID 69268670) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-(aminomethyl)-7-(2,5-dimethylphenyl)-4-ethylheptanoic acid.
| Compound Name | 2-(aminomethyl)-7-(2,5-dimethylphenyl)-4-ethylheptanoic acid |
|---|---|
| PubChem CID | 69268670 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-(aminomethyl)-7-(2,5-dimethylphenyl)-4-ethylheptanoic acid |
| SMILES | CCC(CCCc1cc(C)ccc1C)CC(CN)C(=O)O |
| InChI | InChI=1S/C18H29NO2/c1-4-15(11-17(12-19)18(20)21)6-5-7-16-10-13(2)8-9-14(16)3/h8-10,15,17H,4-7,11-12,19H2,1-3H3,(H,20,21) |
| InChIKey | ZSVOATXGSKXFFE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |