C15H21F2NO2 — CID 69269319
2-(aminomethyl)-6-(3,4-difluorophenyl)-4-ethylhexanoic acid (PubChem CID 69269319) has the molecular formula C15H21F2NO2 and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-(aminomethyl)-6-(3,4-difluorophenyl)-4-ethylhexanoic acid.
| Compound Name | 2-(aminomethyl)-6-(3,4-difluorophenyl)-4-ethylhexanoic acid |
|---|---|
| PubChem CID | 69269319 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-(aminomethyl)-6-(3,4-difluorophenyl)-4-ethylhexanoic acid |
| SMILES | CCC(CCc1ccc(F)c(F)c1)CC(CN)C(=O)O |
| InChI | InChI=1S/C15H21F2NO2/c1-2-10(7-12(9-18)15(19)20)3-4-11-5-6-13(16)14(17)8-11/h5-6,8,10,12H,2-4,7,9,18H2,1H3,(H,19,20) |
| InChIKey | OJFTVLHMRQOFIH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |