C17H21F6NO4 — CID 87760722
2-(aminomethyl)-6-[3,5-bis(trifluoromethoxy)phenyl]-4-ethylhexanoic acid (PubChem CID 87760722) has the molecular formula C17H21F6NO4 and a molecular weight of 417.35 g/mol. Its IUPAC name is 2-(aminomethyl)-6-[3,5-bis(trifluoromethoxy)phenyl]-4-ethylhexanoic acid.
| Compound Name | 2-(aminomethyl)-6-[3,5-bis(trifluoromethoxy)phenyl]-4-ethylhexanoic acid |
|---|---|
| PubChem CID | 87760722 |
| Molecular Formula | C17H21F6NO4 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-(aminomethyl)-6-[3,5-bis(trifluoromethoxy)phenyl]-4-ethylhexanoic acid |
| SMILES | CCC(CCc1cc(OC(F)(F)F)cc(OC(F)(F)F)c1)CC(CN)C(=O)O |
| InChI | InChI=1S/C17H21F6NO4/c1-2-10(5-12(9-24)15(25)26)3-4-11-6-13(27-16(18,19)20)8-14(7-11)28-17(21,22)23/h6-8,10,12H,2-5,9,24H2,1H3,(H,25,26) |
| InChIKey | VQJJPVNNQLZSHU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |