C16H22F3NO3 — CID 69268098
2-(aminomethyl)-4-ethyl-6-[4-(trifluoromethoxy)phenyl]hexanoic acid (PubChem CID 69268098) has the molecular formula C16H22F3NO3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-(aminomethyl)-4-ethyl-6-[4-(trifluoromethoxy)phenyl]hexanoic acid.
| Compound Name | 2-(aminomethyl)-4-ethyl-6-[4-(trifluoromethoxy)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 69268098 |
| Molecular Formula | C16H22F3NO3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-(aminomethyl)-4-ethyl-6-[4-(trifluoromethoxy)phenyl]hexanoic acid |
| SMILES | CCC(CCc1ccc(OC(F)(F)F)cc1)CC(CN)C(=O)O |
| InChI | InChI=1S/C16H22F3NO3/c1-2-11(9-13(10-20)15(21)22)3-4-12-5-7-14(8-6-12)23-16(17,18)19/h5-8,11,13H,2-4,9-10,20H2,1H3,(H,21,22) |
| InChIKey | RRSNLDCIQHHBSM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |