C20H33NO4 — CID 69268808
2-(aminomethyl)-7-(3,5-diethoxyphenyl)-4-ethylheptanoic acid (PubChem CID 69268808) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-(aminomethyl)-7-(3,5-diethoxyphenyl)-4-ethylheptanoic acid.
| Compound Name | 2-(aminomethyl)-7-(3,5-diethoxyphenyl)-4-ethylheptanoic acid |
|---|---|
| PubChem CID | 69268808 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 2-(aminomethyl)-7-(3,5-diethoxyphenyl)-4-ethylheptanoic acid |
| SMILES | CCOc1cc(CCCC(CC)CC(CN)C(=O)O)cc(OCC)c1 |
| InChI | InChI=1S/C20H33NO4/c1-4-15(10-17(14-21)20(22)23)8-7-9-16-11-18(24-5-2)13-19(12-16)25-6-3/h11-13,15,17H,4-10,14,21H2,1-3H3,(H,22,23) |
| InChIKey | YDKMDWCCKREFMZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |