C19H31NO5 — CID 69267992
2-(aminomethyl)-4-(2,4,6-triethoxyphenyl)hexanoic acid (PubChem CID 69267992) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-(aminomethyl)-4-(2,4,6-triethoxyphenyl)hexanoic acid.
| Compound Name | 2-(aminomethyl)-4-(2,4,6-triethoxyphenyl)hexanoic acid |
|---|---|
| PubChem CID | 69267992 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 2-(aminomethyl)-4-(2,4,6-triethoxyphenyl)hexanoic acid |
| SMILES | CCOc1cc(OCC)c(C(CC)CC(CN)C(=O)O)c(OCC)c1 |
| InChI | InChI=1S/C19H31NO5/c1-5-13(9-14(12-20)19(21)22)18-16(24-7-3)10-15(23-6-2)11-17(18)25-8-4/h10-11,13-14H,5-9,12,20H2,1-4H3,(H,21,22) |
| InChIKey | RDUUXCMEDRHSAE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |