C20H33NO5 — CID 69269613
2-(aminomethyl)-4-methyl-6-(2,3,6-triethoxyphenyl)hexanoic acid (PubChem CID 69269613) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-(aminomethyl)-4-methyl-6-(2,3,6-triethoxyphenyl)hexanoic acid.
| Compound Name | 2-(aminomethyl)-4-methyl-6-(2,3,6-triethoxyphenyl)hexanoic acid |
|---|---|
| PubChem CID | 69269613 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 2-(aminomethyl)-4-methyl-6-(2,3,6-triethoxyphenyl)hexanoic acid |
| SMILES | CCOc1ccc(OCC)c(OCC)c1CCC(C)CC(CN)C(=O)O |
| InChI | InChI=1S/C20H33NO5/c1-5-24-17-10-11-18(25-6-2)19(26-7-3)16(17)9-8-14(4)12-15(13-21)20(22)23/h10-11,14-15H,5-9,12-13,21H2,1-4H3,(H,22,23) |
| InChIKey | RUEFKJRTZGKEMV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |