C20H33NO5 — CID 174497696
methyl 2-amino-4-methyl-6-(2,3,6-triethoxyphenyl)hexanoate (PubChem CID 174497696) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is methyl 2-amino-4-methyl-6-(2,3,6-triethoxyphenyl)hexanoate.
| Compound Name | methyl 2-amino-4-methyl-6-(2,3,6-triethoxyphenyl)hexanoate |
|---|---|
| PubChem CID | 174497696 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | methyl 2-amino-4-methyl-6-(2,3,6-triethoxyphenyl)hexanoate |
| SMILES | CCOc1ccc(OCC)c(OCC)c1CCC(C)CC(N)C(=O)OC |
| InChI | InChI=1S/C20H33NO5/c1-6-24-17-11-12-18(25-7-2)19(26-8-3)15(17)10-9-14(4)13-16(21)20(22)23-5/h11-12,14,16H,6-10,13,21H2,1-5H3 |
| InChIKey | XAJNQPVKGRFUSB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |