2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid

C21H35NO5 — CID 150769283

IUPAC2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid
SMILESCCOc1ccc(CCCC(C)CC(C)(N)C(=O)O)c(OCC)c1OCC
InChIInChI=1S/C21H35NO5/c1-6-25-17-13-12-16(18(26-7-2)19(17)27-8-3)11-9-10-15(4)14-21(5,22)20(23)24/h12-13,15H,6-11,14,22H2,1-5H3,(H,23,24)
InChIKeyJZNFFFHGHXNRFM-UHFFFAOYSA-N
MW381.51 g/mol
LogP4.03
Rot. Bonds13

About 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid

2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid (PubChem CID 150769283) has the molecular formula C21H35NO5 and a molecular weight of 381.51 g/mol. Its IUPAC name is 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid.

Molecular Properties

Compound Name2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid
PubChem CID150769283
Molecular FormulaC21H35NO5
Molecular Weight381.51 g/mol
Exact Mass381.25
IUPAC Name2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid
SMILESCCOc1ccc(CCCC(C)CC(C)(N)C(=O)O)c(OCC)c1OCC
InChIInChI=1S/C21H35NO5/c1-6-25-17-13-12-16(18(26-7-2)19(17)27-8-3)11-9-10-15(4)14-21(5,22)20(23)24/h12-13,15H,6-11,14,22H2,1-5H3,(H,23,24)
InChIKeyJZNFFFHGHXNRFM-UHFFFAOYSA-N
XLogP4.03
TPSA91.01 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds13
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500381.51
LogP ≤ 54.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid?
The IUPAC name of 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid (CID 150769283) is 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid.
What is the SMILES notation for 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid?
The canonical SMILES for 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid is CCOc1ccc(CCCC(C)CC(C)(N)C(=O)O)c(OCC)c1OCC.
What is the InChIKey of 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid?
The InChIKey is JZNFFFHGHXNRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35NO5/c1-6-25-17-13-12-16(18(26-7-2)19(17)27-8-3)11-9-10-15(4)14-21(5,22)20(23)24/h12-13,15H,6-11,14,22H2,1-5H3,(H,23,24).
What are the key properties of 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid?
2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid has a molecular weight of 381.51 g/mol, XLogP of 4.03, 13 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid is sourced from PubChem (CID 150769283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).