C21H35NO5 — CID 150769283
2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid (PubChem CID 150769283) has the molecular formula C21H35NO5 and a molecular weight of 381.51 g/mol. Its IUPAC name is 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid.
| Compound Name | 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid |
|---|---|
| PubChem CID | 150769283 |
| Molecular Formula | C21H35NO5 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 2-amino-2,4-dimethyl-7-(2,3,4-triethoxyphenyl)heptanoic acid |
| SMILES | CCOc1ccc(CCCC(C)CC(C)(N)C(=O)O)c(OCC)c1OCC |
| InChI | InChI=1S/C21H35NO5/c1-6-25-17-13-12-16(18(26-7-2)19(17)27-8-3)11-9-10-15(4)14-21(5,22)20(23)24/h12-13,15H,6-11,14,22H2,1-5H3,(H,23,24) |
| InChIKey | JZNFFFHGHXNRFM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |