C17H24F3NO3 — CID 152742384
2-amino-4-ethyl-2-methyl-7-[2-(trifluoromethoxy)phenyl]heptanoic acid (PubChem CID 152742384) has the molecular formula C17H24F3NO3 and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-amino-4-ethyl-2-methyl-7-[2-(trifluoromethoxy)phenyl]heptanoic acid.
| Compound Name | 2-amino-4-ethyl-2-methyl-7-[2-(trifluoromethoxy)phenyl]heptanoic acid |
|---|---|
| PubChem CID | 152742384 |
| Molecular Formula | C17H24F3NO3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-amino-4-ethyl-2-methyl-7-[2-(trifluoromethoxy)phenyl]heptanoic acid |
| SMILES | CCC(CCCc1ccccc1OC(F)(F)F)CC(C)(N)C(=O)O |
| InChI | InChI=1S/C17H24F3NO3/c1-3-12(11-16(2,21)15(22)23)7-6-9-13-8-4-5-10-14(13)24-17(18,19)20/h4-5,8,10,12H,3,6-7,9,11,21H2,1-2H3,(H,22,23) |
| InChIKey | ZZWNALRPNNASPW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |