C14H18F3NO3 — CID 65061764
2-[ethyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]-2-methylpropanoic acid (PubChem CID 65061764) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-[ethyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 65061764 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[ethyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]-2-methylpropanoic acid |
| SMILES | CCN(Cc1ccccc1OC(F)(F)F)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H18F3NO3/c1-4-18(13(2,3)12(19)20)9-10-7-5-6-8-11(10)21-14(15,16)17/h5-8H,4,9H2,1-3H3,(H,19,20) |
| InChIKey | LUSBLYQKULLFBG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |