C11H13F3N2O2 — CID 119278536
2-amino-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide (PubChem CID 119278536) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 2-amino-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-amino-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 119278536 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-amino-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide |
| SMILES | CN(Cc1ccccc1OC(F)(F)F)C(=O)CN |
| InChI | InChI=1S/C11H13F3N2O2/c1-16(10(17)6-15)7-8-4-2-3-5-9(8)18-11(12,13)14/h2-5H,6-7,15H2,1H3 |
| InChIKey | WGVKKNIOOFIHMH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |