C19H19F4NO3 — CID 55939528
4-(2-fluorophenoxy)-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]butanamide (PubChem CID 55939528) has the molecular formula C19H19F4NO3 and a molecular weight of 385.36 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]butanamide.
| Compound Name | 4-(2-fluorophenoxy)-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 55939528 |
| Molecular Formula | C19H19F4NO3 |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-(2-fluorophenoxy)-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]butanamide |
| SMILES | CN(Cc1ccccc1OC(F)(F)F)C(=O)CCCOc1ccccc1F |
| InChI | InChI=1S/C19H19F4NO3/c1-24(13-14-7-2-4-9-16(14)27-19(21,22)23)18(25)11-6-12-26-17-10-5-3-8-15(17)20/h2-5,7-10H,6,11-13H2,1H3 |
| InChIKey | PHZQVVDHAGVMNJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|