C18H19F3N2O2 — CID 120666980
2-amino-N-methyl-2-(4-methylphenyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide (PubChem CID 120666980) has the molecular formula C18H19F3N2O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-amino-N-methyl-2-(4-methylphenyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-amino-N-methyl-2-(4-methylphenyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 120666980 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-amino-N-methyl-2-(4-methylphenyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide |
| SMILES | Cc1ccc(C(N)C(=O)N(C)Cc2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2O2/c1-12-7-9-13(10-8-12)16(22)17(24)23(2)11-14-5-3-4-6-15(14)25-18(19,20)21/h3-10,16H,11,22H2,1-2H3 |
| InChIKey | FGUVEGGXRVXNHT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |