C19H16F6O3 — CID 174483817
1,5-bis[2-(trifluoromethoxy)phenyl]pentan-3-one (PubChem CID 174483817) has the molecular formula C19H16F6O3 and a molecular weight of 406.32 g/mol. Its IUPAC name is 1,5-bis[2-(trifluoromethoxy)phenyl]pentan-3-one.
| Compound Name | 1,5-bis[2-(trifluoromethoxy)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 174483817 |
| Molecular Formula | C19H16F6O3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1,5-bis[2-(trifluoromethoxy)phenyl]pentan-3-one |
| SMILES | O=C(CCc1ccccc1OC(F)(F)F)CCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C19H16F6O3/c20-18(21,22)27-16-7-3-1-5-13(16)9-11-15(26)12-10-14-6-2-4-8-17(14)28-19(23,24)25/h1-8H,9-12H2 |
| InChIKey | AXFMOOHEDJCENW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |