C16H23F3N2O2 — CID 119571159
N-[3-(aminomethyl)pentan-3-yl]-3-[2-(trifluoromethoxy)phenyl]propanamide (PubChem CID 119571159) has the molecular formula C16H23F3N2O2 and a molecular weight of 332.37 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-3-[2-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-3-[2-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 119571159 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-3-[2-(trifluoromethoxy)phenyl]propanamide |
| SMILES | CCC(CC)(CN)NC(=O)CCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H23F3N2O2/c1-3-15(4-2,11-20)21-14(22)10-9-12-7-5-6-8-13(12)23-16(17,18)19/h5-8H,3-4,9-11,20H2,1-2H3,(H,21,22) |
| InChIKey | PFRTWINRDRJGFW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |