C16H27ClN2O2 — CID 119569079
N-[3-(aminomethyl)pentan-3-yl]-2-(2-ethylphenoxy)acetamide;hydrochloride (PubChem CID 119569079) has the molecular formula C16H27ClN2O2 and a molecular weight of 314.86 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-2-(2-ethylphenoxy)acetamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-2-(2-ethylphenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119569079 |
| Molecular Formula | C16H27ClN2O2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-2-(2-ethylphenoxy)acetamide;hydrochloride |
| SMILES | CCc1ccccc1OCC(=O)NC(CC)(CC)CN.Cl |
| InChI | InChI=1S/C16H26N2O2.ClH/c1-4-13-9-7-8-10-14(13)20-11-15(19)18-16(5-2,6-3)12-17;/h7-10H,4-6,11-12,17H2,1-3H3,(H,18,19);1H |
| InChIKey | RKMIIMOBSIKIPY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |