C15H22F2N2O — CID 119571102
N-[3-(aminomethyl)pentan-3-yl]-3-(2,5-difluorophenyl)propanamide (PubChem CID 119571102) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-3-(2,5-difluorophenyl)propanamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-3-(2,5-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 119571102 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-3-(2,5-difluorophenyl)propanamide |
| SMILES | CCC(CC)(CN)NC(=O)CCc1cc(F)ccc1F |
| InChI | InChI=1S/C15H22F2N2O/c1-3-15(4-2,10-18)19-14(20)8-5-11-9-12(16)6-7-13(11)17/h6-7,9H,3-5,8,10,18H2,1-2H3,(H,19,20) |
| InChIKey | RJOPRAPMQHPTBN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |