C19H14Cl2F6O3 — CID 175245898
1,5-bis[5-chloro-2-(trifluoromethoxy)phenyl]pentan-3-one (PubChem CID 175245898) has the molecular formula C19H14Cl2F6O3 and a molecular weight of 475.21 g/mol. Its IUPAC name is 1,5-bis[5-chloro-2-(trifluoromethoxy)phenyl]pentan-3-one.
| Compound Name | 1,5-bis[5-chloro-2-(trifluoromethoxy)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 175245898 |
| Molecular Formula | C19H14Cl2F6O3 |
| Molecular Weight | 475.21 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | 1,5-bis[5-chloro-2-(trifluoromethoxy)phenyl]pentan-3-one |
| SMILES | O=C(CCc1cc(Cl)ccc1OC(F)(F)F)CCc1cc(Cl)ccc1OC(F)(F)F |
| InChI | InChI=1S/C19H14Cl2F6O3/c20-13-3-7-16(29-18(22,23)24)11(9-13)1-5-15(28)6-2-12-10-14(21)4-8-17(12)30-19(25,26)27/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | NWWQLHSVBRXPLZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.21 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |