C17H16Cl2O3 — CID 174781443
1,5-bis(4-chloro-2-hydroxyphenyl)pentan-3-one (PubChem CID 174781443) has the molecular formula C17H16Cl2O3 and a molecular weight of 339.22 g/mol. Its IUPAC name is 1,5-bis(4-chloro-2-hydroxyphenyl)pentan-3-one.
| Compound Name | 1,5-bis(4-chloro-2-hydroxyphenyl)pentan-3-one |
|---|---|
| PubChem CID | 174781443 |
| Molecular Formula | C17H16Cl2O3 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1,5-bis(4-chloro-2-hydroxyphenyl)pentan-3-one |
| SMILES | O=C(CCc1ccc(Cl)cc1O)CCc1ccc(Cl)cc1O |
| InChI | InChI=1S/C17H16Cl2O3/c18-13-5-1-11(16(21)9-13)3-7-15(20)8-4-12-2-6-14(19)10-17(12)22/h1-2,5-6,9-10,21-22H,3-4,7-8H2 |
| InChIKey | ARJZEOHDBFYBKZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |