C15H19F4NO2 — CID 151160778
2-amino-4-ethyl-2-methyl-6-(2,3,5,6-tetrafluorophenyl)hexanoic acid (PubChem CID 151160778) has the molecular formula C15H19F4NO2 and a molecular weight of 321.31 g/mol. Its IUPAC name is 2-amino-4-ethyl-2-methyl-6-(2,3,5,6-tetrafluorophenyl)hexanoic acid.
| Compound Name | 2-amino-4-ethyl-2-methyl-6-(2,3,5,6-tetrafluorophenyl)hexanoic acid |
|---|---|
| PubChem CID | 151160778 |
| Molecular Formula | C15H19F4NO2 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-amino-4-ethyl-2-methyl-6-(2,3,5,6-tetrafluorophenyl)hexanoic acid |
| SMILES | CCC(CCc1c(F)c(F)cc(F)c1F)CC(C)(N)C(=O)O |
| InChI | InChI=1S/C15H19F4NO2/c1-3-8(7-15(2,20)14(21)22)4-5-9-12(18)10(16)6-11(17)13(9)19/h6,8H,3-5,7,20H2,1-2H3,(H,21,22) |
| InChIKey | NAFGYHUNXOBLPO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|