C18H29NO4 — CID 150561865
2-amino-7-(3,5-dimethoxyphenyl)-4-ethyl-2-methylheptanoic acid (PubChem CID 150561865) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 2-amino-7-(3,5-dimethoxyphenyl)-4-ethyl-2-methylheptanoic acid.
| Compound Name | 2-amino-7-(3,5-dimethoxyphenyl)-4-ethyl-2-methylheptanoic acid |
|---|---|
| PubChem CID | 150561865 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-amino-7-(3,5-dimethoxyphenyl)-4-ethyl-2-methylheptanoic acid |
| SMILES | CCC(CCCc1cc(OC)cc(OC)c1)CC(C)(N)C(=O)O |
| InChI | InChI=1S/C18H29NO4/c1-5-13(12-18(2,19)17(20)21)7-6-8-14-9-15(22-3)11-16(10-14)23-4/h9-11,13H,5-8,12,19H2,1-4H3,(H,20,21) |
| InChIKey | IKAADUFIDORCGT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |