C12H18O2 — CID 524875
1-butyl-3,5-dimethoxybenzene (PubChem CID 524875) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-butyl-3,5-dimethoxybenzene.
| Compound Name | 1-butyl-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 524875 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-butyl-3,5-dimethoxybenzene |
| SMILES | CCCCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C12H18O2/c1-4-5-6-10-7-11(13-2)9-12(8-10)14-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | JNAVXGYUAXCROD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |