sodium 2-(3,5-dimethoxyphenyl)ethanolate

C10H13NaO3 — CID 175142417

IUPACsodium 2-(3,5-dimethoxyphenyl)ethanolate
SMILESCOc1cc(CC[O-])cc(OC)c1.[Na+]
InChIInChI=1S/C10H13O3.Na/c1-12-9-5-8(3-4-11)6-10(7-9)13-2;/h5-7H,3-4H2,1-2H3;/q-1;+1
InChIKeyCNDHTZQRBSFZRN-UHFFFAOYSA-N
MW204.20 g/mol
LogP-2.39
Rot. Bonds4

About sodium 2-(3,5-dimethoxyphenyl)ethanolate

sodium 2-(3,5-dimethoxyphenyl)ethanolate (PubChem CID 175142417) has the molecular formula C10H13NaO3 and a molecular weight of 204.20 g/mol. Its IUPAC name is sodium 2-(3,5-dimethoxyphenyl)ethanolate.

Molecular Properties

Compound Namesodium 2-(3,5-dimethoxyphenyl)ethanolate
PubChem CID175142417
Molecular FormulaC10H13NaO3
Molecular Weight204.20 g/mol
Exact Mass204.08
IUPAC Namesodium 2-(3,5-dimethoxyphenyl)ethanolate
SMILESCOc1cc(CC[O-])cc(OC)c1.[Na+]
InChIInChI=1S/C10H13O3.Na/c1-12-9-5-8(3-4-11)6-10(7-9)13-2;/h5-7H,3-4H2,1-2H3;/q-1;+1
InChIKeyCNDHTZQRBSFZRN-UHFFFAOYSA-N
XLogP-2.39
TPSA41.52 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.20
LogP ≤ 5-2.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze sodium 2-(3,5-dimethoxyphenyl)ethanolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-(3,5-dimethoxyphenyl)ethanolate?
The IUPAC name of sodium 2-(3,5-dimethoxyphenyl)ethanolate (CID 175142417) is sodium 2-(3,5-dimethoxyphenyl)ethanolate.
What is the SMILES notation for sodium 2-(3,5-dimethoxyphenyl)ethanolate?
The canonical SMILES for sodium 2-(3,5-dimethoxyphenyl)ethanolate is COc1cc(CC[O-])cc(OC)c1.[Na+].
What is the InChIKey of sodium 2-(3,5-dimethoxyphenyl)ethanolate?
The InChIKey is CNDHTZQRBSFZRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13O3.Na/c1-12-9-5-8(3-4-11)6-10(7-9)13-2;/h5-7H,3-4H2,1-2H3;/q-1;+1.
What are the key properties of sodium 2-(3,5-dimethoxyphenyl)ethanolate?
sodium 2-(3,5-dimethoxyphenyl)ethanolate has a molecular weight of 204.20 g/mol, XLogP of -2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(3,5-dimethoxyphenyl)ethanolate is sourced from PubChem (CID 175142417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).