C10H13NaO3 — CID 175142417
sodium 2-(3,5-dimethoxyphenyl)ethanolate (PubChem CID 175142417) has the molecular formula C10H13NaO3 and a molecular weight of 204.20 g/mol. Its IUPAC name is sodium 2-(3,5-dimethoxyphenyl)ethanolate.
| Compound Name | sodium 2-(3,5-dimethoxyphenyl)ethanolate |
|---|---|
| PubChem CID | 175142417 |
| Molecular Formula | C10H13NaO3 |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | sodium 2-(3,5-dimethoxyphenyl)ethanolate |
| SMILES | COc1cc(CC[O-])cc(OC)c1.[Na+] |
| InChI | InChI=1S/C10H13O3.Na/c1-12-9-5-8(3-4-11)6-10(7-9)13-2;/h5-7H,3-4H2,1-2H3;/q-1;+1 |
| InChIKey | CNDHTZQRBSFZRN-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |