C13H22O5Si — CID 59566880
2-(3,5-dimethoxyphenyl)ethyl-trimethoxysilane (PubChem CID 59566880) has the molecular formula C13H22O5Si and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)ethyl-trimethoxysilane.
| Compound Name | 2-(3,5-dimethoxyphenyl)ethyl-trimethoxysilane |
|---|---|
| PubChem CID | 59566880 |
| Molecular Formula | C13H22O5Si |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)ethyl-trimethoxysilane |
| SMILES | COc1cc(CC[Si](OC)(OC)OC)cc(OC)c1 |
| InChI | InChI=1S/C13H22O5Si/c1-14-12-8-11(9-13(10-12)15-2)6-7-19(16-3,17-4)18-5/h8-10H,6-7H2,1-5H3 |
| InChIKey | DGCGOSFETYCNRA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|