C10H13NO3 — CID 132967337
1,3-dimethoxy-5-(2-nitrosoethyl)benzene (PubChem CID 132967337) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1,3-dimethoxy-5-(2-nitrosoethyl)benzene.
| Compound Name | 1,3-dimethoxy-5-(2-nitrosoethyl)benzene |
|---|---|
| PubChem CID | 132967337 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1,3-dimethoxy-5-(2-nitrosoethyl)benzene |
| SMILES | COc1cc(CCN=O)cc(OC)c1 |
| InChI | InChI=1S/C10H13NO3/c1-13-9-5-8(3-4-11-12)6-10(7-9)14-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | BOBHLEXOPZTUPR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |