(2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid

C13H19NO4 — CID 172529766

IUPAC(2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid
SMILESCN[C@@H](CCc1cc(OC)cc(OC)c1)C(=O)O
InChIInChI=1S/C13H19NO4/c1-14-12(13(15)16)5-4-9-6-10(17-2)8-11(7-9)18-3/h6-8,12,14H,4-5H2,1-3H3,(H,15,16)/t12-/m0/s1
InChIKeyULNSOFRETTVNTP-LBPRGKRZSA-N
MW253.30 g/mol
LogP1.31
Rot. Bonds7

About (2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid

(2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid (PubChem CID 172529766) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is (2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid.

Molecular Properties

Compound Name(2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid
PubChem CID172529766
Molecular FormulaC13H19NO4
Molecular Weight253.30 g/mol
Exact Mass253.13
IUPAC Name(2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid
SMILESCN[C@@H](CCc1cc(OC)cc(OC)c1)C(=O)O
InChIInChI=1S/C13H19NO4/c1-14-12(13(15)16)5-4-9-6-10(17-2)8-11(7-9)18-3/h6-8,12,14H,4-5H2,1-3H3,(H,15,16)/t12-/m0/s1
InChIKeyULNSOFRETTVNTP-LBPRGKRZSA-N
XLogP1.31
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.30
LogP ≤ 51.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid?
The IUPAC name of (2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid (CID 172529766) is (2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid.
What is the SMILES notation for (2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid?
The canonical SMILES for (2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid is CN[C@@H](CCc1cc(OC)cc(OC)c1)C(=O)O.
What is the InChIKey of (2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid?
The InChIKey is ULNSOFRETTVNTP-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H19NO4/c1-14-12(13(15)16)5-4-9-6-10(17-2)8-11(7-9)18-3/h6-8,12,14H,4-5H2,1-3H3,(H,15,16)/t12-/m0/s1.
What are the key properties of (2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid?
(2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid has a molecular weight of 253.30 g/mol, XLogP of 1.31, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(3,5-dimethoxyphenyl)-2-(methylamino)butanoic acid is sourced from PubChem (CID 172529766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).