C13H19NO5 — CID 116932024
2-(methylamino)-3-(2,4,6-trimethoxyphenyl)propanoic acid (PubChem CID 116932024) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(methylamino)-3-(2,4,6-trimethoxyphenyl)propanoic acid.
| Compound Name | 2-(methylamino)-3-(2,4,6-trimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 116932024 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-(methylamino)-3-(2,4,6-trimethoxyphenyl)propanoic acid |
| SMILES | CNC(Cc1c(OC)cc(OC)cc1OC)C(=O)O |
| InChI | InChI=1S/C13H19NO5/c1-14-10(13(15)16)7-9-11(18-3)5-8(17-2)6-12(9)19-4/h5-6,10,14H,7H2,1-4H3,(H,15,16) |
| InChIKey | LEYACSDZFZCWMI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |