C20H25NO5 — CID 141372630
methyl 3-phenyl-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoate (PubChem CID 141372630) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is methyl 3-phenyl-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoate.
| Compound Name | methyl 3-phenyl-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 141372630 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | methyl 3-phenyl-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NCc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C20H25NO5/c1-23-15-11-18(24-2)16(19(12-15)25-3)13-21-17(20(22)26-4)10-14-8-6-5-7-9-14/h5-9,11-12,17,21H,10,13H2,1-4H3 |
| InChIKey | GVFGXNBFUKEZHV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |