C13H19NO5S — CID 174778343
3-sulfanyl-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoic acid (PubChem CID 174778343) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 3-sulfanyl-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoic acid.
| Compound Name | 3-sulfanyl-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 174778343 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-sulfanyl-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoic acid |
| SMILES | COc1cc(OC)c(CNC(CS)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C13H19NO5S/c1-17-8-4-11(18-2)9(12(5-8)19-3)6-14-10(7-20)13(15)16/h4-5,10,14,20H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | HFYQYZJEBWRMCT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|