C13H19NO4 — CID 82364659
2-[(2,5-dimethoxyphenyl)methylamino]butanoic acid (PubChem CID 82364659) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)methylamino]butanoic acid.
| Compound Name | 2-[(2,5-dimethoxyphenyl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 82364659 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)methylamino]butanoic acid |
| SMILES | CCC(NCc1cc(OC)ccc1OC)C(=O)O |
| InChI | InChI=1S/C13H19NO4/c1-4-11(13(15)16)14-8-9-7-10(17-2)5-6-12(9)18-3/h5-7,11,14H,4,8H2,1-3H3,(H,15,16) |
| InChIKey | NFBUCSZKIKOZNJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |