C13H16ClNO4 — CID 43388208
2-[[2-(5-chloro-2-methoxyphenyl)acetyl]amino]butanoic acid (PubChem CID 43388208) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-[[2-(5-chloro-2-methoxyphenyl)acetyl]amino]butanoic acid.
| Compound Name | 2-[[2-(5-chloro-2-methoxyphenyl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43388208 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-[[2-(5-chloro-2-methoxyphenyl)acetyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)Cc1cc(Cl)ccc1OC)C(=O)O |
| InChI | InChI=1S/C13H16ClNO4/c1-3-10(13(17)18)15-12(16)7-8-6-9(14)4-5-11(8)19-2/h4-6,10H,3,7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | KBVFEPMNHYTWPO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |