C11H14ClNO3 — CID 60700587
2-(5-chloro-2-methoxyphenyl)-N-ethoxyacetamide (PubChem CID 60700587) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-N-ethoxyacetamide.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-N-ethoxyacetamide |
|---|---|
| PubChem CID | 60700587 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-N-ethoxyacetamide |
| SMILES | CCONC(=O)Cc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C11H14ClNO3/c1-3-16-13-11(14)7-8-6-9(12)4-5-10(8)15-2/h4-6H,3,7H2,1-2H3,(H,13,14) |
| InChIKey | NXJDXDIQMHXOLC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|