C11H14ClNO3 — CID 51690857
(2R)-2-[(5-chloro-2-methoxyphenyl)methylamino]propanoic acid (PubChem CID 51690857) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is (2R)-2-[(5-chloro-2-methoxyphenyl)methylamino]propanoic acid.
| Compound Name | (2R)-2-[(5-chloro-2-methoxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 51690857 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2R)-2-[(5-chloro-2-methoxyphenyl)methylamino]propanoic acid |
| SMILES | COc1ccc(Cl)cc1CN[C@H](C)C(=O)O |
| InChI | InChI=1S/C11H14ClNO3/c1-7(11(14)15)13-6-8-5-9(12)3-4-10(8)16-2/h3-5,7,13H,6H2,1-2H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | PZXZXLKKXUHLBH-SSDOTTSWSA-N |
| XLogP | 1.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |