C12H18ClNO2 — CID 43410849
N-[(5-chloro-2-methoxyphenyl)methyl]-1-methoxypropan-2-amine (PubChem CID 43410849) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-1-methoxypropan-2-amine.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-1-methoxypropan-2-amine |
|---|---|
| PubChem CID | 43410849 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-1-methoxypropan-2-amine |
| SMILES | COCC(C)NCc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C12H18ClNO2/c1-9(8-15-2)14-7-10-6-11(13)4-5-12(10)16-3/h4-6,9,14H,7-8H2,1-3H3 |
| InChIKey | TVFDSYLPHGBJRP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |