C13H19Cl2NO2 — CID 114162976
3-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-4-methoxybutan-1-amine (PubChem CID 114162976) has the molecular formula C13H19Cl2NO2 and a molecular weight of 292.21 g/mol. Its IUPAC name is 3-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-4-methoxybutan-1-amine.
| Compound Name | 3-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 114162976 |
| Molecular Formula | C13H19Cl2NO2 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-4-methoxybutan-1-amine |
| SMILES | COCC(Cl)CCNCc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C13H19Cl2NO2/c1-17-9-12(15)5-6-16-8-10-7-11(14)3-4-13(10)18-2/h3-4,7,12,16H,5-6,8-9H2,1-2H3 |
| InChIKey | NQSMNBCYSZAKDR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|