C15H16Cl3NO — CID 17331816
N-[(5-chloro-2-methoxyphenyl)methyl]-1-(2-chlorophenyl)methanamine;hydrochloride (PubChem CID 17331816) has the molecular formula C15H16Cl3NO and a molecular weight of 332.66 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-1-(2-chlorophenyl)methanamine;hydrochloride.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-1-(2-chlorophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 17331816 |
| Molecular Formula | C15H16Cl3NO |
| Molecular Weight | 332.66 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-1-(2-chlorophenyl)methanamine;hydrochloride |
| SMILES | COc1ccc(Cl)cc1CNCc1ccccc1Cl.Cl |
| InChI | InChI=1S/C15H15Cl2NO.ClH/c1-19-15-7-6-13(16)8-12(15)10-18-9-11-4-2-3-5-14(11)17;/h2-8,18H,9-10H2,1H3;1H |
| InChIKey | ZUOLDQVUHGVMSZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |