C12H16ClF2NO2 — CID 103081267
N-[(5-chloro-2-methoxyphenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine (PubChem CID 103081267) has the molecular formula C12H16ClF2NO2 and a molecular weight of 279.71 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 103081267 |
| Molecular Formula | C12H16ClF2NO2 |
| Molecular Weight | 279.71 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine |
| SMILES | COc1ccc(Cl)cc1CNCCOCC(F)F |
| InChI | InChI=1S/C12H16ClF2NO2/c1-17-11-3-2-10(13)6-9(11)7-16-4-5-18-8-12(14)15/h2-3,6,12,16H,4-5,7-8H2,1H3 |
| InChIKey | ATEXAPACAKELRW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|