C13H18ClF2NO3 — CID 103081067
N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine (PubChem CID 103081067) has the molecular formula C13H18ClF2NO3 and a molecular weight of 309.74 g/mol. Its IUPAC name is N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine.
| Compound Name | N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 103081067 |
| Molecular Formula | C13H18ClF2NO3 |
| Molecular Weight | 309.74 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine |
| SMILES | COc1cc(CNCCOCC(F)F)cc(Cl)c1OC |
| InChI | InChI=1S/C13H18ClF2NO3/c1-18-11-6-9(5-10(14)13(11)19-2)7-17-3-4-20-8-12(15)16/h5-6,12,17H,3-4,7-8H2,1-2H3 |
| InChIKey | OMMGCKADPOQSOL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|