C18H23Cl2NO3 — CID 17207350
N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride (PubChem CID 17207350) has the molecular formula C18H23Cl2NO3 and a molecular weight of 372.29 g/mol. Its IUPAC name is N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17207350 |
| Molecular Formula | C18H23Cl2NO3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride |
| SMILES | COc1ccccc1CCNCc1cc(Cl)c(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C18H22ClNO3.ClH/c1-21-16-7-5-4-6-14(16)8-9-20-12-13-10-15(19)18(23-3)17(11-13)22-2;/h4-7,10-11,20H,8-9,12H2,1-3H3;1H |
| InChIKey | XRSXNRZURXVDRD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|