C26H31Cl2NO3 — CID 17207465
N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride (PubChem CID 17207465) has the molecular formula C26H31Cl2NO3 and a molecular weight of 476.44 g/mol. Its IUPAC name is N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17207465 |
| Molecular Formula | C26H31Cl2NO3 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2-methoxyphenyl)ethanamine;hydrochloride |
| SMILES | CCOc1cc(CNCCc2ccccc2OC)cc(Cl)c1OCc1ccc(C)cc1.Cl |
| InChI | InChI=1S/C26H30ClNO3.ClH/c1-4-30-25-16-21(17-28-14-13-22-7-5-6-8-24(22)29-3)15-23(27)26(25)31-18-20-11-9-19(2)10-12-20;/h5-12,15-16,28H,4,13-14,17-18H2,1-3H3;1H |
| InChIKey | SLKNFELODIICEH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|