C13H19Cl2NO — CID 79245397
1-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-3-methylbutan-2-amine (PubChem CID 79245397) has the molecular formula C13H19Cl2NO and a molecular weight of 276.21 g/mol. Its IUPAC name is 1-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-3-methylbutan-2-amine.
| Compound Name | 1-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 79245397 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-3-methylbutan-2-amine |
| SMILES | COc1ccc(Cl)cc1CNC(CCl)C(C)C |
| InChI | InChI=1S/C13H19Cl2NO/c1-9(2)12(7-14)16-8-10-6-11(15)4-5-13(10)17-3/h4-6,9,12,16H,7-8H2,1-3H3 |
| InChIKey | RGSJKDSBZDNFDR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|