C14H21Cl2NO — CID 65026055
1-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-4-methylpentan-2-amine (PubChem CID 65026055) has the molecular formula C14H21Cl2NO and a molecular weight of 290.23 g/mol. Its IUPAC name is 1-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-4-methylpentan-2-amine.
| Compound Name | 1-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 65026055 |
| Molecular Formula | C14H21Cl2NO |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-4-methylpentan-2-amine |
| SMILES | COc1ccc(Cl)cc1CNC(CCl)CC(C)C |
| InChI | InChI=1S/C14H21Cl2NO/c1-10(2)6-13(8-15)17-9-11-7-12(16)4-5-14(11)18-3/h4-5,7,10,13,17H,6,8-9H2,1-3H3 |
| InChIKey | NMUIVWHMHCMQEB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|