C10H11ClN2O4 — CID 83194014
(2S)-2-[(5-chloro-2-nitrophenyl)methylamino]propanoic acid (PubChem CID 83194014) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is (2S)-2-[(5-chloro-2-nitrophenyl)methylamino]propanoic acid.
| Compound Name | (2S)-2-[(5-chloro-2-nitrophenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 83194014 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (2S)-2-[(5-chloro-2-nitrophenyl)methylamino]propanoic acid |
| SMILES | C[C@H](NCc1cc(Cl)ccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C10H11ClN2O4/c1-6(10(14)15)12-5-7-4-8(11)2-3-9(7)13(16)17/h2-4,6,12H,5H2,1H3,(H,14,15)/t6-/m0/s1 |
| InChIKey | KSUFWJPGMCTWSM-LURJTMIESA-N |
| XLogP | 1.81 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|