C12H13ClN2O4 — CID 79580843
2-[(5-chloro-2-nitrophenyl)methylamino]-2-cyclopropylacetic acid (PubChem CID 79580843) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is 2-[(5-chloro-2-nitrophenyl)methylamino]-2-cyclopropylacetic acid.
| Compound Name | 2-[(5-chloro-2-nitrophenyl)methylamino]-2-cyclopropylacetic acid |
|---|---|
| PubChem CID | 79580843 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-[(5-chloro-2-nitrophenyl)methylamino]-2-cyclopropylacetic acid |
| SMILES | O=C(O)C(NCc1cc(Cl)ccc1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C12H13ClN2O4/c13-9-3-4-10(15(18)19)8(5-9)6-14-11(12(16)17)7-1-2-7/h3-5,7,11,14H,1-2,6H2,(H,16,17) |
| InChIKey | PKRQMPQGOTUPRB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|