C15H23NO4 — CID 120511723
(2S)-2-[(2,4-dimethoxyphenyl)methylamino]hexanoic acid (PubChem CID 120511723) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (2S)-2-[(2,4-dimethoxyphenyl)methylamino]hexanoic acid.
| Compound Name | (2S)-2-[(2,4-dimethoxyphenyl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 120511723 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (2S)-2-[(2,4-dimethoxyphenyl)methylamino]hexanoic acid |
| SMILES | CCCC[C@H](NCc1ccc(OC)cc1OC)C(=O)O |
| InChI | InChI=1S/C15H23NO4/c1-4-5-6-13(15(17)18)16-10-11-7-8-12(19-2)9-14(11)20-3/h7-9,13,16H,4-6,10H2,1-3H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | AWSJLZIAESBBBJ-ZDUSSCGKSA-N |
| XLogP | 2.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |