C15H20N2O3S — CID 120511784
(2S)-2-[(6-methoxy-1,3-benzothiazol-2-yl)methylamino]hexanoic acid (PubChem CID 120511784) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is (2S)-2-[(6-methoxy-1,3-benzothiazol-2-yl)methylamino]hexanoic acid.
| Compound Name | (2S)-2-[(6-methoxy-1,3-benzothiazol-2-yl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 120511784 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (2S)-2-[(6-methoxy-1,3-benzothiazol-2-yl)methylamino]hexanoic acid |
| SMILES | CCCC[C@H](NCc1nc2ccc(OC)cc2s1)C(=O)O |
| InChI | InChI=1S/C15H20N2O3S/c1-3-4-5-12(15(18)19)16-9-14-17-11-7-6-10(20-2)8-13(11)21-14/h6-8,12,16H,3-5,9H2,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | JQLUJSLZAUWIJH-LBPRGKRZSA-N |
| XLogP | 3.04 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |