C9H8N2O2S — CID 123202651
6-methoxy-2-(nitrosomethyl)-1,3-benzothiazole (PubChem CID 123202651) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is 6-methoxy-2-(nitrosomethyl)-1,3-benzothiazole.
| Compound Name | 6-methoxy-2-(nitrosomethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 123202651 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 6-methoxy-2-(nitrosomethyl)-1,3-benzothiazole |
| SMILES | COc1ccc2nc(CN=O)sc2c1 |
| InChI | InChI=1S/C9H8N2O2S/c1-13-6-2-3-7-8(4-6)14-9(11-7)5-10-12/h2-4H,5H2,1H3 |
| InChIKey | UWBKABFFLJZNAC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |