C16H12N2O2S4 — CID 20537765
6-methoxy-2-[(6-methoxy-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole (PubChem CID 20537765) has the molecular formula C16H12N2O2S4 and a molecular weight of 392.55 g/mol. Its IUPAC name is 6-methoxy-2-[(6-methoxy-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole.
| Compound Name | 6-methoxy-2-[(6-methoxy-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 20537765 |
| Molecular Formula | C16H12N2O2S4 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | 6-methoxy-2-[(6-methoxy-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole |
| SMILES | COc1ccc2nc(SSc3nc4ccc(OC)cc4s3)sc2c1 |
| InChI | InChI=1S/C16H12N2O2S4/c1-19-9-3-5-11-13(7-9)21-15(17-11)23-24-16-18-12-6-4-10(20-2)8-14(12)22-16/h3-8H,1-2H3 |
| InChIKey | QERWHLCKGQAKFU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|