C9H6NNaO3S — CID 23680135
sodium 6-methoxy-1,3-benzothiazole-2-carboxylate (PubChem CID 23680135) has the molecular formula C9H6NNaO3S and a molecular weight of 231.21 g/mol. Its IUPAC name is sodium 6-methoxy-1,3-benzothiazole-2-carboxylate.
| Compound Name | sodium 6-methoxy-1,3-benzothiazole-2-carboxylate |
|---|---|
| PubChem CID | 23680135 |
| Molecular Formula | C9H6NNaO3S |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | sodium 6-methoxy-1,3-benzothiazole-2-carboxylate |
| SMILES | COc1ccc2nc(C(=O)[O-])sc2c1.[Na+] |
| InChI | InChI=1S/C9H7NO3S.Na/c1-13-5-2-3-6-7(4-5)14-8(10-6)9(11)12;/h2-4H,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | MFHMJBIDQHWWQU-UHFFFAOYSA-M |
| XLogP | -2.33 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |